Explain a radioisotope source containing

Assignment Help Chemistry
Reference no: EM13233035

Dr. Brown has a radioisotope source containing 1.2 x 106 (also written as 1.2E+06) atoms of Plutonium-238 in 1985, how many atoms will remain in 352 years

Reference no: EM13233035

Questions Cloud

Explains how hackers can hide their own ip address : Explains how hackers can hide their own IP address when attacking other computers, and how administrators can thwart this type of cracking
Explain what is the ph during the titration : What is the pH during the titration of 25.00mL of 0.10M NH3 (Kb = 1.8 x 10-5) after the addition of 10.00mL of 0.10M HCl titrant?
Why firm incurs no fixed costs but has constant marginal : Suppose that two firms compete in quantities (Cournot) in a market in which demand is described by P = 260 - 2Q. Each firm incurs no fixed costs but has a constant marginal cost of 20. Suppose that after the cartel is established, one firm decides ..
Define the amoeba and paramecium : What structures in Amoeba and Paramecium also occur in plantcells, Which do not occur in plant cells, How does shape and body consistency differ between amoeba and paramecium
Explain a radioisotope source containing : Dr. Brown has a radioisotope source containing 1.2 x 106 (also written as 1.2E+06) atoms of Plutonium-238 in 1985, how many atoms will remain in 352 years
Explain what a buffer overflow is how it can be used : Explain what a buffer overflow is, how it can be used by an attacker, and how to prevent such as an attack.
What is the one-period nash equilibrium market price : Suppose that two firms compete in quantities (Cournot) in a market in which demand is described by P = 260 - 2Q. Each firm incurs no fixed costs but has a constant marginal cost of 20. a. What is the one-period Nash equilibrium market price
Describe various types of dos attacks and techniques for pre : Describe various types of DoS attacks and techniques for preventingthem
How big steel should use information on the supply of steel : The other, smaller manufacturers set their price based on that established by Big Steel. Discuss how Big Steel should use the information on the supply of steel by other, smaller competitors when it determines its profit maximizing price.

Reviews

Write a Review

Chemistry Questions & Answers

  Explain how many molecules of acetyl coa are produced

Olive oil is comprised of 80% oleic acid, CH3(CH2)7CH=CH(CH2)7COOH. How many molecules of acetyl CoA are produced by catabolism of oleic acid

  Why we call benzene phenyl and not benzyle

why we call benzene phenyl and not benzyle when one hydrogen is removed because in case of alkanes we name them alkyl on the removal of one hydrogen atom.

  State moles of gas are there in a gas-filled balloon

How many moles of gas are there in a gas-filled balloon, which has a volume of 67.0 L at a pressure of 742 mmHg and a temperature of 25.0°C?

  By how much would the ph change

Consider a solution of a weak acid at a pH equal to its pKa. By how much would the pH change, and in which direction, if we added to this solution enough base to neutralize 10% of the total acid?

  State the concentrations are for a through d

A reaction where A +B ? C +D has a ? Go' of 5 kcal/mole and the concentrations are for A through D, respectively 10 mM, 5 mM, 2 mM and 3 mM. Find the ?G' and state if favorable or not.

  Explain and write the cell diagram for the daniell cell

The standard reduction potential for Zn2+ is -0.76 volt and that of Cu2+ is 0.34 volt.a) Write the cell diagram for the Daniell cell (NH4NO3 salt bridge).

  Explain cyclopentadiene reacts as a diene

Explain Cyclopentadiene reacts as a diene in the the Diels-Alder reaction a great deal faster than does 1,3 butadiene.

  State oxidized to an optically inactive dicarboxylic acid c

With aqueous H2CrO4, compound A was oxidized to an optically inactive dicarboxylic acid C, C6H10O4. Give structures for compounds A, B, and C; do not specify stereochemistry.

  Compute the temperature of the water

calculate the final temperature of the water after all the ice melts. heat capacity of H2O: 37.7 J/mol*k heat capacity of H2O l: 75.3 J/mol*k enthalpy of fusion of H2O: 6.01 kJ/mol

  What is the molarity of the ethanol in this solution

A solution of ethanol (C2H5OH) in water is prepared by dissolving 58.0 mL of ethanol (density = 0.79 g/cm3) in enough water to make 235.0 mL of solution. What is the molarity of the ethanol in this solution?

  What is a possible molecular formula for the hydrocarbon

a 54.1 gram sample of an unknown hydrocarbon was burned in an excess of oxygen to form 88.0grams of carbon dioxide and 27.0grams of water. what is a possible molecular formula for the hydrocarbon?

  What is the percent by mass of carbon in the compound

A 53.6 gram sample of an unknown substance contains 11.5 grams of carbon. What is the percent by mass of carbon in the compound?

Free Assignment Quote

Assured A++ Grade

Get guaranteed satisfaction & time on delivery in every assignment order you paid with us! We ensure premium quality solution document along with free turntin report!

All rights reserved! Copyrights ©2019-2020 ExpertsMind IT Educational Pvt Ltd