Already have an account? Get multiple benefits of using own account!
Login in your account..!
Remember me
Don't have an account? Create your account in less than a minutes,
Forgot password? how can I recover my password now!
Enter right registered email to receive password!
Question- Calculate the equilibrium concentrations of Na+, Cl?,H+, CHO?2, and HCHO2when 50.0mL of 0.50 M HCl is mixed with 50.0mL of 0.50 M NaCHO2.
[Na+]=[Cl-]=[H+]=[CHO2]=[HCHO2]=
Must comprise steps of computation of equilibrium
What do the elements in each group have in common. A block is formed by the 28 elements set off at the bottom of the periodic table. What do these elements have in common
Look up the chemical compound that is methiocarb and describe briefly its chemistry and its pharmacology and what effects does Methiocarb have on the mammalian body? What other signs/symptoms would Jimmy display? Can this chemical cause death? Why?
Calculate the change in its standard molar Gibbs free energy when benzene is heated from 25 ºC to 45 ºC.
Each carbon-oxygen bond is somewhere between a single and a double bond. 3.Each oxygen atom has a double bond 50% of the time 4. The actual structure of formate is an average of the two resonance forms
Neat, aliphatic, primary amines show two absorptions between 3400 to 3330 cm-1 and 3330 to 3250 cm-1 due respectively to asymmetrical and symmetrical stretch. Stretch at 3300 cm-1. Why do tertiary amines not absorb in this region of the spectrum?
Based on crystal field theory, which of the subsequent metal ions will not be colored when placed in an octahedral crystal field
considering the given equations and calculate the heat of the reaction of 3h2g o2g ---gt 3h2og from the heats of
2NOCl(g) → 2NO(g) + Cl2(g) ,At 450 K the rate constant is 15.4 atm-1s-1. How much time (in s) is needed for NOCl originally at a partial pressure of 46 torr to decay to 25.8 torr.
Compute how many milliliters of 0.626 M KOH must be added to 5.00 g of MOBS to give a pH of 7.40. Note that the pKa of MOBS is 7.48 as well as the Formula Mass is 223.29 g/mol.
Prepare a standard of lidocaine in methanol with a final concentration of 1.00 mg/mL using the powder lidocaine/HCl. Show the calculations and explain how you take the salt form into account.
Nitromethane will absorb 240nm light. Assuming that each nitromethane molecule absorbs 1 photon, how many molecules would it take to absorb 1 kJ of light at 240nm
Suppose it is found that the actual molecular mass of your unknown solid is exactly two times larger than that which you determined experimentally. What could you conclude about the nature of your unknown solid and the assumptions you made in your..
Get guaranteed satisfaction & time on delivery in every assignment order you paid with us! We ensure premium quality solution document along with free turntin report!
whatsapp: +1-415-670-9521
Phone: +1-415-670-9521
Email: [email protected]
All rights reserved! Copyrights ©2019-2020 ExpertsMind IT Educational Pvt Ltd