State what is the ph of this buffer solution

Assignment Help Chemistry
Reference no: EM13166514

A buffer solution is made by mixing 0.102 moles of sodium nitrite (NaNO2) in 1.00 L of 0.125 M nitrous acid (HNO2).
Ksp = 4.5*10^-4

a.) What is the pH of this buffer solution? (Neglect the volume change that occurs with addition of solid sodium nitrite)

b.) Calculate the pH when 2.00 mL of 0.0275 M NaOH are added to 50.0 mL of buffer solution.

Reference no: EM13166514

Questions Cloud

Compute the concentrations of all species solution : Calculate the concentrations of all species in a 1.00 M Na2SO3 (sodium sulfite) solution. The ionization constants for sulfurous acid are Ka1 = 1.4× 10-2 and Ka2 = 6.3× 10-8.
Explain the ability of an electron to cross through a node : How can we explain the ability of an electron to cross through a node, such as the nucleus, to occupy the region within an entire orbital?
How many photons are in the laser pulse : A laser pulse with wavelength 555 contains 4.40 of energy. How many photons are in the laser pulse?
What is the composition of the mixture by volume : A gas mixture composed of helium and argon has a density of 0.727g/L at a 755mmHg and 298K .What is the composition of the mixture by volume?
State what is the ph of this buffer solution : What is the pH of this buffer solution? (Neglect the volume change that occurs with addition of solid sodium nitrite) b.) Calculate the pH when 2.00 mL of 0.0275 M NaOH are added to 50.0 mL of buffer solution.
Which substances form molecular crystals in solid form : Which of the following substances form molecular crystals in solid form?
Compute the alberts net tax payable : The Alberts would like to know how much the mortgage payments would increase net of any change in their income tax.
Determine the empirical formula for each substance : Determine the empirical formula for each substance.
What is the inner diameter of cylinder : A 10.0 long cylindrical glass tube, sealed at one end, is filled with ethanol. The mass of ethanol needed to fill the tube is found to be 11.90 . The density of ethanol is 0.789 . what is the inner diameter of cylinder?

Reviews

Write a Review

Chemistry Questions & Answers

  What is the value of the rate constant

At 400°K , 0.20 M NO and 0.10 M Cl2 were mixed. The reaction rate was found to be 3.04 ? 10-6 M/s. What is the value of the rate constant, k?

  What is the final volume of the gas

A 37.4-L volume of methane gas is heated from 22 degrees C to 78 degrees C at constant pressure. What is the final volume of the gas?

  What does a yellow flame in the bunsen burner indicate

What does a yellow flame in the Bunsen burner indicate? How can this be corrected? Why use a funnel to transfer large volume of liquid from one container to another?

  What mass of water would be present

A an aqueous methanol (CH3OH) solution has a mole fraction of 0.430 of methanol. What mass of water would be present in 706 g of this solution?

  Compute the number of rads

Compute the number of rads and rems of radiation in five years from such a level of plutonium.

  Calculate the partial pressure (in atmospheres) of each gas

Assuming that the total pressure of the gases is 1.52 atm and that their mole ratio is 94 : 4.0 : 1.5 : 0.50, calculate the partial pressure (in atmospheres) of each gas.

  Determine the trend in sizes of the ions

Determine the trend in sizes of the ions O 2- ,N 3- , F - and also explain why does the trend exist? Also describe which of the molecules contains polar covalent bonds but is NOT itself a polar molecule?

  Explain need to sample from a concentration

How long would you need to sample from a concentration of 1000 PPM using a flow rate of 50 ml/minute to collect 100 mg of material?

  Calculate the volume of koh required

A volume of 80.0 mL of a 0.520 it M HNO_3 solution is titrated with 0.590 it M KOH. Calculate the volume of KOH required to reach the equivalence point?

  Calculate the equilibrium concentrations of ch3cl

In a basic aqueous solution, chloromethane undergoes a substitution reaction in which Cl- is replaced by OH-: CH3Cl(aq)+OH-(aq) CH3OH(aq) + Cl-(aq)

  Explain how many molecules of acetyl coa are produced

Olive oil is comprised of 80% oleic acid, CH3(CH2)7CH=CH(CH2)7COOH. How many molecules of acetyl CoA are produced by catabolism of oleic acid

  How many moles of acetylene (c2h2) will be produced

If 7.00 mol calcium carbide (CaC2) reacts with an excess of water, how many moles of acetylene (C2H2) will be produced?

Free Assignment Quote

Assured A++ Grade

Get guaranteed satisfaction & time on delivery in every assignment order you paid with us! We ensure premium quality solution document along with free turntin report!

All rights reserved! Copyrights ©2019-2020 ExpertsMind IT Educational Pvt Ltd